C12H11I2NO2S — CID 11179262
1-(benzenesulfonyl)-2-(2,2-diiodoethyl)pyrrole (PubChem CID 11179262) has the molecular formula C12H11I2NO2S and a molecular weight of 487.10 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(2,2-diiodoethyl)pyrrole.
| Compound Name | 1-(benzenesulfonyl)-2-(2,2-diiodoethyl)pyrrole |
|---|---|
| PubChem CID | 11179262 |
| Molecular Formula | C12H11I2NO2S |
| Molecular Weight | 487.10 g/mol |
| Exact Mass | 486.86 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(2,2-diiodoethyl)pyrrole |
| SMILES | O=S(=O)(c1ccccc1)n1cccc1CC(I)I |
| InChI | InChI=1S/C12H11I2NO2S/c13-12(14)9-10-5-4-8-15(10)18(16,17)11-6-2-1-3-7-11/h1-8,12H,9H2 |
| InChIKey | XXCHHHOGTWGCPJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|