C26H23N3O2S2 — CID 141134439
N-[[1-(benzenesulfonyl)pyrrol-2-yl]methyl]-1-(3-phenylsulfanyl-1H-indol-6-yl)methanamine (PubChem CID 141134439) has the molecular formula C26H23N3O2S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)pyrrol-2-yl]methyl]-1-(3-phenylsulfanyl-1H-indol-6-yl)methanamine.
| Compound Name | N-[[1-(benzenesulfonyl)pyrrol-2-yl]methyl]-1-(3-phenylsulfanyl-1H-indol-6-yl)methanamine |
|---|---|
| PubChem CID | 141134439 |
| Molecular Formula | C26H23N3O2S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[[1-(benzenesulfonyl)pyrrol-2-yl]methyl]-1-(3-phenylsulfanyl-1H-indol-6-yl)methanamine |
| SMILES | O=S(=O)(c1ccccc1)n1cccc1CNCc1ccc2c(Sc3ccccc3)c[nH]c2c1 |
| InChI | InChI=1S/C26H23N3O2S2/c30-33(31,23-11-5-2-6-12-23)29-15-7-8-21(29)18-27-17-20-13-14-24-25(16-20)28-19-26(24)32-22-9-3-1-4-10-22/h1-16,19,27-28H,17-18H2 |
| InChIKey | NTACBEXTGBORAR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |