About 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid
2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174754206) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 174754206 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | CCC1CC2CCC12.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C8H14/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-2-6-5-7-3-4-8(6)7/h2-4H,1H3,(H,10,11)(H,12,13);6-8H,2-5H2,1H3 |
| InChIKey | DEVHVFVKGQOEHC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid (CID 174754206) is 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid is CCC1CC2CCC12.Cc1ccc(C(=O)O)cc1C(=O)O.
What is the InChIKey of 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is DEVHVFVKGQOEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C8H14/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-2-6-5-7-3-4-8(6)7/h2-4H,1H3,(H,10,11)(H,12,13);6-8H,2-5H2,1H3.
What are the key properties of 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid?
2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 290.36 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbicyclo[2.2.0]hexane;4-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174754206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).