C14H12F6N4O — CID 171932868
N-[(1R)-2-azidocyclopentyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 171932868) has the molecular formula C14H12F6N4O and a molecular weight of 366.27 g/mol. Its IUPAC name is N-[(1R)-2-azidocyclopentyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(1R)-2-azidocyclopentyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171932868 |
| Molecular Formula | C14H12F6N4O |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[(1R)-2-azidocyclopentyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | [N-]=[N+]=NC1CCC[C@H]1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F6N4O/c15-13(16,17)8-4-7(5-9(6-8)14(18,19)20)12(25)22-10-2-1-3-11(10)23-24-21/h4-6,10-11H,1-3H2,(H,22,25)/t10-,11?/m1/s1 |
| InChIKey | HKGTZDDMOWWEDN-NFJWQWPMSA-N |
| XLogP | 4.69 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|