About N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide
N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 91198965) has the molecular formula C13H10F6N4O2
and a molecular weight of 368.24 g/mol. Its IUPAC name is N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide |
| PubChem CID | 91198965 |
| Molecular Formula | C13H10F6N4O2 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | [N-]=[N+]=NC1COCC1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F6N4O2/c14-12(15,16)7-1-6(2-8(3-7)13(17,18)19)11(24)21-9-4-25-5-10(9)22-23-20/h1-3,9-10H,4-5H2,(H,21,24) |
| InChIKey | CFCQJURSTZWGPF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The IUPAC name of N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide (CID 91198965) is N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide.
What is the SMILES notation for N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The canonical SMILES for N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide is [N-]=[N+]=NC1COCC1NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide?
The InChIKey is CFCQJURSTZWGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F6N4O2/c14-12(15,16)7-1-6(2-8(3-7)13(17,18)19)11(24)21-9-4-25-5-10(9)22-23-20/h1-3,9-10H,4-5H2,(H,21,24).
What are the key properties of N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide?
N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide has a molecular weight of 368.24 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-azidooxolan-3-yl)-3,5-bis(trifluoromethyl)benzamide is sourced from PubChem (CID 91198965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).