C16H15F6NO4 — CID 120547872
2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547872) has the molecular formula C16H15F6NO4 and a molecular weight of 399.29 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547872 |
| Molecular Formula | C16H15F6NO4 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCOC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F6NO4/c17-15(18,19)10-4-9(5-11(6-10)16(20,21)22)13(24)23-12(14(25)26)8-2-1-3-27-7-8/h4-6,8,12H,1-3,7H2,(H,23,24)(H,25,26) |
| InChIKey | PZAOLUUIJRKHIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |