C12H12N6O5 — CID 102186473
N-[(1S,2S)-2-azidocyclopentyl]-3,5-dinitrobenzamide (PubChem CID 102186473) has the molecular formula C12H12N6O5 and a molecular weight of 320.27 g/mol. Its IUPAC name is N-[(1S,2S)-2-azidocyclopentyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(1S,2S)-2-azidocyclopentyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 102186473 |
| Molecular Formula | C12H12N6O5 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-[(1S,2S)-2-azidocyclopentyl]-3,5-dinitrobenzamide |
| SMILES | [N-]=[N+]=N[C@H]1CCC[C@@H]1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N6O5/c13-16-15-11-3-1-2-10(11)14-12(19)7-4-8(17(20)21)6-9(5-7)18(22)23/h4-6,10-11H,1-3H2,(H,14,19)/t10-,11-/m0/s1 |
| InChIKey | SXJIYRZJYVGIFV-QWRGUYRKSA-N |
| XLogP | 2.46 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|