C18H17N3O5S — CID 101490077
3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzamide (PubChem CID 101490077) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzamide.
| Compound Name | 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 101490077 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]1Sc1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N3O5S/c22-18(12-9-13(20(23)24)11-14(10-12)21(25)26)19-16-7-4-8-17(16)27-15-5-2-1-3-6-15/h1-3,5-6,9-11,16-17H,4,7-8H2,(H,19,22)/t16-,17-/m1/s1 |
| InChIKey | ZJTROJKCMXDECE-IAGOWNOFSA-N |
| XLogP | 3.95 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|