C18H19N3O4S — CID 164676511
3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclohexyl]aniline (PubChem CID 164676511) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclohexyl]aniline.
| Compound Name | 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclohexyl]aniline |
|---|---|
| PubChem CID | 164676511 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3,5-dinitro-N-[(1R,2R)-2-phenylsulfanylcyclohexyl]aniline |
| SMILES | O=[N+]([O-])c1cc(N[C@@H]2CCCC[C@H]2Sc2ccccc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O4S/c22-20(23)14-10-13(11-15(12-14)21(24)25)19-17-8-4-5-9-18(17)26-16-6-2-1-3-7-16/h1-3,6-7,10-12,17-19H,4-5,8-9H2/t17-,18-/m1/s1 |
| InChIKey | LJEMKLHOYPYIIR-QZTJIDSGSA-N |
| XLogP | 5.02 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|