C13H19N3O3 — CID 102738670
trans-(1R,2R)-2-N-(3-methoxy-5-nitrophenyl)cyclohexane-1,2-diamine (PubChem CID 102738670) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-(3-methoxy-5-nitrophenyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-(3-methoxy-5-nitrophenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102738670 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | trans-(1R,2R)-2-N-(3-methoxy-5-nitrophenyl)cyclohexane-1,2-diamine |
| SMILES | COc1cc(N[C@@H]2CCCC[C@H]2N)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N3O3/c1-19-11-7-9(6-10(8-11)16(17)18)15-13-5-3-2-4-12(13)14/h6-8,12-13,15H,2-5,14H2,1H3/t12-,13-/m1/s1 |
| InChIKey | VARQATMDIFXEOX-CHWSQXEVSA-N |
| XLogP | 2.29 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|