C12H16N4O4 — CID 40507750
cis-(1R,2S)-2-N-(2,4-dinitrophenyl)cyclohexane-1,2-diamine (PubChem CID 40507750) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is cis-(1R,2S)-2-N-(2,4-dinitrophenyl)cyclohexane-1,2-diamine.
| Compound Name | cis-(1R,2S)-2-N-(2,4-dinitrophenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 40507750 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | cis-(1R,2S)-2-N-(2,4-dinitrophenyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@@H]1Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O4/c13-9-3-1-2-4-10(9)14-11-6-5-8(15(17)18)7-12(11)16(19)20/h5-7,9-10,14H,1-4,13H2/t9-,10+/m1/s1 |
| InChIKey | JXBSDLZLJPIEJN-ZJUUUORDSA-N |
| XLogP | 2.18 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|