C19H24N2O2 — CID 50975798
N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(cyclobutanecarbonylamino)benzamide (PubChem CID 50975798) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(cyclobutanecarbonylamino)benzamide.
| Compound Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(cyclobutanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 50975798 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-(cyclobutanecarbonylamino)benzamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1C2)c1ccc(NC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c22-18(13-2-1-3-13)20-16-8-6-14(7-9-16)19(23)21-17-11-12-4-5-15(17)10-12/h6-9,12-13,15,17H,1-5,10-11H2,(H,20,22)(H,21,23)/t12-,15+,17+/m0/s1 |
| InChIKey | XZGWPETXOLUOAP-XGWLTEMNSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |