C21H24Cl2N6 — CID 111306041
2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine (PubChem CID 111306041) has the molecular formula C21H24Cl2N6 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine.
| Compound Name | 2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111306041 |
| Molecular Formula | C21H24Cl2N6 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-benzyl-1-[(3,4-dichlorophenyl)methyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methylguanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccc2)N(C)Cc2ccc(Cl)c(Cl)c2)n1C |
| InChI | InChI=1S/C21H24Cl2N6/c1-15-26-27-20(29(15)3)13-25-21(24-12-16-7-5-4-6-8-16)28(2)14-17-9-10-18(22)19(23)11-17/h4-11H,12-14H2,1-3H3,(H,24,25) |
| InChIKey | UZSBENPYZHUALL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|