C21H29IN6O — CID 111518304
1-[1-(1-benzofuran-2-yl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111518304) has the molecular formula C21H29IN6O and a molecular weight of 508.41 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518304 |
| Molecular Formula | C21H29IN6O |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\NCCn1cnnc1CC)NC(C)c1cc2ccccc2o1.I |
| InChI | InChI=1S/C21H28N6O.HI/c1-5-20-26-24-14-27(20)11-10-22-21(23-13-15(2)3)25-16(4)19-12-17-8-6-7-9-18(17)28-19;/h6-9,12,14,16H,2,5,10-11,13H2,1,3-4H3,(H2,22,23,25);1H |
| InChIKey | NTDYAUCJVOHOEF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|