C18H33N7 — CID 111513650
1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111513650) has the molecular formula C18H33N7 and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111513650 |
| Molecular Formula | C18H33N7 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\NCCn1cnnc1CC)NCC1CCCN1CC |
| InChI | InChI=1S/C18H33N7/c1-5-17-23-22-14-25(17)11-9-19-18(20-12-15(3)4)21-13-16-8-7-10-24(16)6-2/h14,16H,3,5-13H2,1-2,4H3,(H2,19,20,21) |
| InChIKey | PXZBZABEPILPRF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|