C19H29IN8 — CID 111701156
2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111701156) has the molecular formula C19H29IN8 and a molecular weight of 496.40 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111701156 |
| Molecular Formula | C19H29IN8 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2[nH]1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C19H28N8.HI/c1-3-18-26-23-14-27(18)13-12-22-19(20-4-2)21-11-7-10-17-24-15-8-5-6-9-16(15)25-17;/h5-6,8-9,14H,3-4,7,10-13H2,1-2H3,(H,24,25)(H2,20,21,22);1H |
| InChIKey | ZEBSMVCSLSYCGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|