C20H39IN8O2 — CID 111701548
tert-butyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111701548) has the molecular formula C20H39IN8O2 and a molecular weight of 550.49 g/mol. Its IUPAC name is tert-butyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111701548 |
| Molecular Formula | C20H39IN8O2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | tert-butyl 4-[2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCN(C(=O)OC(C)(C)C)CC1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C20H38N8O2.HI/c1-6-17-25-24-16-28(17)11-9-23-18(21-7-2)22-8-10-26-12-14-27(15-13-26)19(29)30-20(3,4)5;/h16H,6-15H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | VCBRQHYJLHRXMG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|