C20H40IN7O2 — CID 111701660
tert-butyl N-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide (PubChem CID 111701660) has the molecular formula C20H40IN7O2 and a molecular weight of 537.49 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111701660 |
| Molecular Formula | C20H40IN7O2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C(=O)OC(C)(C)C)C(C)C)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C20H39N7O2.HI/c1-8-17-25-24-15-26(17)14-12-23-18(21-9-2)22-11-10-13-27(16(3)4)19(28)29-20(5,6)7;/h15-16H,8-14H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | JLTKMHBLZVDADI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|