C20H37N7O2 — CID 111700485
tert-butyl 2-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]piperidine-1-carboxylate (PubChem CID 111700485) has the molecular formula C20H37N7O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is tert-butyl 2-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111700485 |
| Molecular Formula | C20H37N7O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | tert-butyl 2-[[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC1CCCCN1C(=O)OC(C)(C)C)NCCn1cnnc1CC |
| InChI | InChI=1S/C20H37N7O2/c1-6-17-25-24-15-26(17)13-11-22-18(21-7-2)23-14-16-10-8-9-12-27(16)19(28)29-20(3,4)5/h15-16H,6-14H2,1-5H3,(H2,21,22,23) |
| InChIKey | ATNVGHGEOXEHEZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|