C19H35N7O2 — CID 111700493
tert-butyl 3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111700493) has the molecular formula C19H35N7O2 and a molecular weight of 393.54 g/mol. Its IUPAC name is tert-butyl 3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111700493 |
| Molecular Formula | C19H35N7O2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | tert-butyl 3-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCc1nncn1CCN/C(=N\C)NCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H35N7O2/c1-6-16-24-23-14-26(16)11-9-21-17(20-5)22-12-15-8-7-10-25(13-15)18(27)28-19(2,3)4/h14-15H,6-13H2,1-5H3,(H2,20,21,22) |
| InChIKey | VJBYKFJAUNTRED-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|