C18H21F3IN3O3 — CID 111805639
1-(3,4-dimethoxyphenyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide (PubChem CID 111805639) has the molecular formula C18H21F3IN3O3 and a molecular weight of 511.28 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111805639 |
| Molecular Formula | C18H21F3IN3O3 |
| Molecular Weight | 511.28 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-[2-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCOc2ccccc2C(F)(F)F)cc1OC.I |
| InChI | InChI=1S/C18H20F3N3O3.HI/c1-25-15-8-7-12(11-16(15)26-2)24-17(22)23-9-10-27-14-6-4-3-5-13(14)18(19,20)21;/h3-8,11H,9-10H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | GNFYWZFUHLBJBU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|