C19H23IN4O2 — CID 120606157
2-[(6-oxopiperidin-2-yl)methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide (PubChem CID 120606157) has the molecular formula C19H23IN4O2 and a molecular weight of 466.32 g/mol. Its IUPAC name is 2-[(6-oxopiperidin-2-yl)methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-oxopiperidin-2-yl)methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120606157 |
| Molecular Formula | C19H23IN4O2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[(6-oxopiperidin-2-yl)methyl]-1-(3-phenoxyphenyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCC(=O)N1)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H22N4O2.HI/c20-19(21-13-15-7-5-11-18(24)22-15)23-14-6-4-10-17(12-14)25-16-8-2-1-3-9-16;/h1-4,6,8-10,12,15H,5,7,11,13H2,(H,22,24)(H3,20,21,23);1H |
| InChIKey | POMAWXLVROLRSY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|