C16H25N3O3 — CID 111078463
1-(3,4-dimethoxyphenyl)-2-[(1-hydroxycyclohexyl)methyl]guanidine (PubChem CID 111078463) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(1-hydroxycyclohexyl)methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(1-hydroxycyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111078463 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(1-hydroxycyclohexyl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2(O)CCCCC2)cc1OC |
| InChI | InChI=1S/C16H25N3O3/c1-21-13-7-6-12(10-14(13)22-2)19-15(17)18-11-16(20)8-4-3-5-9-16/h6-7,10,20H,3-5,8-9,11H2,1-2H3,(H3,17,18,19) |
| InChIKey | AGKIWXTTYHQUQT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|