C16H21ClF3N3O2 — CID 122081931
1-(3-chloro-4-methoxyphenyl)-2-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]guanidine (PubChem CID 122081931) has the molecular formula C16H21ClF3N3O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 122081931 |
| Molecular Formula | C16H21ClF3N3O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[1-hydroxy-3-(trifluoromethyl)cyclohexyl]methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2(O)CCCC(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C16H21ClF3N3O2/c1-25-13-5-4-11(7-12(13)17)23-14(21)22-9-15(24)6-2-3-10(8-15)16(18,19)20/h4-5,7,10,24H,2-3,6,8-9H2,1H3,(H3,21,22,23) |
| InChIKey | AYWALILMKGWUOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|