C18H20ClN3O2 — CID 122081881
1-(3-chloro-4-methoxyphenyl)-2-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]guanidine (PubChem CID 122081881) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]guanidine |
|---|---|
| PubChem CID | 122081881 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2(O)CCc3ccccc32)cc1Cl |
| InChI | InChI=1S/C18H20ClN3O2/c1-24-16-7-6-13(10-15(16)19)22-17(20)21-11-18(23)9-8-12-4-2-3-5-14(12)18/h2-7,10,23H,8-9,11H2,1H3,(H3,20,21,22) |
| InChIKey | UZFKUBNBNCOPKV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|