C21H27N3O3 — CID 120602960
1-(3,4-dimethoxyphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine (PubChem CID 120602960) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine |
|---|---|
| PubChem CID | 120602960 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC2(O)C3C4CC5C6C4CC3C6C52)cc1OC |
| InChI | InChI=1S/C21H27N3O3/c1-26-14-4-3-9(5-15(14)27-2)24-20(22)23-8-21(25)18-11-7-12-16-10(11)6-13(18)17(16)19(12)21/h3-5,10-13,16-19,25H,6-8H2,1-2H3,(H3,22,23,24) |
| InChIKey | FHNKFEPSOOYLKP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|