C23H31N3O3 — CID 111081360
1-(3,4-dimethoxyphenyl)-2-[[1-(4-methoxyphenyl)cyclohexyl]methyl]guanidine (PubChem CID 111081360) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[1-(4-methoxyphenyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[1-(4-methoxyphenyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 111081360 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[1-(4-methoxyphenyl)cyclohexyl]methyl]guanidine |
| SMILES | COc1ccc(C2(C/N=C(\N)Nc3ccc(OC)c(OC)c3)CCCCC2)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-27-19-10-7-17(8-11-19)23(13-5-4-6-14-23)16-25-22(24)26-18-9-12-20(28-2)21(15-18)29-3/h7-12,15H,4-6,13-14,16H2,1-3H3,(H3,24,25,26) |
| InChIKey | OBGRPIZSMBVHDS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|