C14H22IN3O3S — CID 111601195
1-(3,4-dimethoxyphenyl)-2-[(3-hydroxythiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111601195) has the molecular formula C14H22IN3O3S and a molecular weight of 439.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[(3-hydroxythiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[(3-hydroxythiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111601195 |
| Molecular Formula | C14H22IN3O3S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[(3-hydroxythiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CC2(O)CCSC2)cc1OC.I |
| InChI | InChI=1S/C14H21N3O3S.HI/c1-19-11-4-3-10(7-12(11)20-2)17-13(15)16-8-14(18)5-6-21-9-14;/h3-4,7,18H,5-6,8-9H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | HVCWEBNBAOWYFR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|