C23H32IN3O — CID 120602945
1-(4-butan-2-ylphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine;hydroiodide (PubChem CID 120602945) has the molecular formula C23H32IN3O and a molecular weight of 493.43 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120602945 |
| Molecular Formula | C23H32IN3O |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[(8-hydroxy-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl)methyl]guanidine;hydroiodide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/CC2(O)C3C4CC5C6C4CC3C6C52)cc1.I |
| InChI | InChI=1S/C23H31N3O.HI/c1-3-11(2)12-4-6-13(7-5-12)26-22(24)25-10-23(27)20-15-9-16-18-14(15)8-17(20)19(18)21(16)23;/h4-7,11,14-21,27H,3,8-10H2,1-2H3,(H3,24,25,26);1H |
| InChIKey | YKKBGWOAKYJFCD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|