C12H16Cl2N4S — CID 15068523
(1E)-1-[amino-(3,4-dichloroanilino)methylidene]-3-butylthiourea (PubChem CID 15068523) has the molecular formula C12H16Cl2N4S and a molecular weight of 319.26 g/mol. Its IUPAC name is (1E)-1-[amino-(3,4-dichloroanilino)methylidene]-3-butylthiourea.
| Compound Name | (1E)-1-[amino-(3,4-dichloroanilino)methylidene]-3-butylthiourea |
|---|---|
| PubChem CID | 15068523 |
| Molecular Formula | C12H16Cl2N4S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (1E)-1-[amino-(3,4-dichloroanilino)methylidene]-3-butylthiourea |
| SMILES | CCCCNC(=S)/N=C(\N)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N4S/c1-2-3-6-16-12(19)18-11(15)17-8-4-5-9(13)10(14)7-8/h4-5,7H,2-3,6H2,1H3,(H4,15,16,17,18,19) |
| InChIKey | XIMYQRFXIWQNMC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|