C15H18Cl2N4O4S — CID 2825028
1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea;but-2-enedioic acid (PubChem CID 2825028) has the molecular formula C15H18Cl2N4O4S and a molecular weight of 421.31 g/mol. Its IUPAC name is 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea;but-2-enedioic acid.
| Compound Name | 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea;but-2-enedioic acid |
|---|---|
| PubChem CID | 2825028 |
| Molecular Formula | C15H18Cl2N4O4S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea;but-2-enedioic acid |
| SMILES | CC(C)NC(=S)N=C(N)Nc1ccc(Cl)c(Cl)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C11H14Cl2N4S.C4H4O4/c1-6(2)15-11(18)17-10(14)16-7-3-4-8(12)9(13)5-7;5-3(6)1-2-4(7)8/h3-6H,1-2H3,(H4,14,15,16,17,18);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KQKOXMKFKOJGEA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|