C9H13BrN2O2 — CID 71751887
(1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate bromide (PubChem CID 71751887) has the molecular formula C9H13BrN2O2 and a molecular weight of 267.16 g/mol. Its IUPAC name is (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate bromide.
| Compound Name | (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate bromide |
|---|---|
| PubChem CID | 71751887 |
| Molecular Formula | C9H13BrN2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate bromide |
| SMILES | [2H]C([2H])([2H])N(C(=O)Oc1ccc[n+](C)c1)C([2H])([2H])[2H].[Br-] |
| InChI | InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1/i1D3,2D3; |
| InChIKey | VNYBTNPBYXSMOO-TXHXQZCNSA-M |
| XLogP | -2.42 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|