C9H13N2O2+ — CID 71751888
(1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate (PubChem CID 71751888) has the molecular formula C9H13N2O2+ and a molecular weight of 187.25 g/mol. Its IUPAC name is (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate.
| Compound Name | (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate |
|---|---|
| PubChem CID | 71751888 |
| Molecular Formula | C9H13N2O2+ |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | (1-methylpyridin-1-ium-3-yl) N,N-bis(trideuteriomethyl)carbamate |
| SMILES | [2H]C([2H])([2H])N(C(=O)Oc1ccc[n+](C)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H13N2O2/c1-10(2)9(12)13-8-5-4-6-11(3)7-8/h4-7H,1-3H3/q+1/i1D3,2D3 |
| InChIKey | RVOLLAQWKVFTGE-WFGJKAKNSA-N |
| XLogP | 0.57 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|