C17H18ClN3O2 — CID 146109848
(1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-6-yl) N,N-dimethylcarbamate chloride (PubChem CID 146109848) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is (1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-6-yl) N,N-dimethylcarbamate chloride.
| Compound Name | (1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-6-yl) N,N-dimethylcarbamate chloride |
|---|---|
| PubChem CID | 146109848 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-6-yl) N,N-dimethylcarbamate chloride |
| SMILES | CN(C)C(=O)Oc1ccc2n(C)c(-c3ccccc3)c[n+]2c1.[Cl-] |
| InChI | InChI=1S/C17H18N3O2.ClH/c1-18(2)17(21)22-14-9-10-16-19(3)15(12-20(16)11-14)13-7-5-4-6-8-13;/h4-12H,1-3H3;1H/q+1;/p-1 |
| InChIKey | YUCCKZQPIGYZLT-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 38.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|