C17H18IN3O2 — CID 155819400
dimethylamino 1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-5-carboxylate iodide (PubChem CID 155819400) has the molecular formula C17H18IN3O2 and a molecular weight of 423.25 g/mol. Its IUPAC name is dimethylamino 1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-5-carboxylate iodide.
| Compound Name | dimethylamino 1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-5-carboxylate iodide |
|---|---|
| PubChem CID | 155819400 |
| Molecular Formula | C17H18IN3O2 |
| Molecular Weight | 423.25 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | dimethylamino 1-methyl-2-phenylimidazo[1,2-a]pyridin-4-ium-5-carboxylate iodide |
| SMILES | CN(C)OC(=O)c1cccc2n(C)c(-c3ccccc3)c[n+]12.[I-] |
| InChI | InChI=1S/C17H18N3O2.HI/c1-18(2)22-17(21)14-10-7-11-16-19(3)15(12-20(14)16)13-8-5-4-6-9-13;/h4-12H,1-3H3;1H/q+1;/p-1 |
| InChIKey | ALAHMQYYQLESDR-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 38.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|