C34H26N3+ — CID 177414101
4-[2-(1-methyl-3-phenylimidazo[1,2-a]pyridin-4-ium-2-yl)ethynyl]-N,N-diphenylaniline (PubChem CID 177414101) has the molecular formula C34H26N3+ and a molecular weight of 476.60 g/mol. Its IUPAC name is 4-[2-(1-methyl-3-phenylimidazo[1,2-a]pyridin-4-ium-2-yl)ethynyl]-N,N-diphenylaniline.
| Compound Name | 4-[2-(1-methyl-3-phenylimidazo[1,2-a]pyridin-4-ium-2-yl)ethynyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 177414101 |
| Molecular Formula | C34H26N3+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[2-(1-methyl-3-phenylimidazo[1,2-a]pyridin-4-ium-2-yl)ethynyl]-N,N-diphenylaniline |
| SMILES | Cn1c(C#Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)c(-c2ccccc2)[n+]2ccccc12 |
| InChI | InChI=1S/C34H26N3/c1-35-32(34(28-13-5-2-6-14-28)36-26-12-11-19-33(35)36)25-22-27-20-23-31(24-21-27)37(29-15-7-3-8-16-29)30-17-9-4-10-18-30/h2-21,23-24,26H,1H3/q+1 |
| InChIKey | CFGUBTCJFOHHLD-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 12.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|