C18H17ClF3N3O2 — CID 146109845
[3-[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]phenyl] N,N-dimethylcarbamate chloride (PubChem CID 146109845) has the molecular formula C18H17ClF3N3O2 and a molecular weight of 399.80 g/mol. Its IUPAC name is [3-[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]phenyl] N,N-dimethylcarbamate chloride.
| Compound Name | [3-[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]phenyl] N,N-dimethylcarbamate chloride |
|---|---|
| PubChem CID | 146109845 |
| Molecular Formula | C18H17ClF3N3O2 |
| Molecular Weight | 399.80 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [3-[1-methyl-6-(trifluoromethyl)imidazo[1,2-a]pyridin-4-ium-2-yl]phenyl] N,N-dimethylcarbamate chloride |
| SMILES | CN(C)C(=O)Oc1cccc(-c2c[n+]3cc(C(F)(F)F)ccc3n2C)c1.[Cl-] |
| InChI | InChI=1S/C18H17F3N3O2.ClH/c1-22(2)17(25)26-14-6-4-5-12(9-14)15-11-24-10-13(18(19,20)21)7-8-16(24)23(15)3;/h4-11H,1-3H3;1H/q+1;/p-1 |
| InChIKey | LTNPREFDHNSTOR-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 38.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.80 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|