C16H11F3N2O2 — CID 162535130
[3-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]phenyl] acetate (PubChem CID 162535130) has the molecular formula C16H11F3N2O2 and a molecular weight of 320.27 g/mol. Its IUPAC name is [3-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]phenyl] acetate.
| Compound Name | [3-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 162535130 |
| Molecular Formula | C16H11F3N2O2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [3-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(-c2cn3cc(C(F)(F)F)ccc3n2)c1 |
| InChI | InChI=1S/C16H11F3N2O2/c1-10(22)23-13-4-2-3-11(7-13)14-9-21-8-12(16(17,18)19)5-6-15(21)20-14/h2-9H,1H3 |
| InChIKey | BMVXNPHULHGFNL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|