C15H13IN2O2 — CID 24880884
2-[3-(6-(125I)iodoimidazo[1,2-a]pyridin-2-yl)phenoxy]ethanol (PubChem CID 24880884) has the molecular formula C15H13IN2O2 and a molecular weight of 378.19 g/mol. Its IUPAC name is 2-[3-(6-(125I)iodoimidazo[1,2-a]pyridin-2-yl)phenoxy]ethanol.
| Compound Name | 2-[3-(6-(125I)iodoimidazo[1,2-a]pyridin-2-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 24880884 |
| Molecular Formula | C15H13IN2O2 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-[3-(6-(125I)iodoimidazo[1,2-a]pyridin-2-yl)phenoxy]ethanol |
| SMILES | OCCOc1cccc(-c2cn3cc([125I])ccc3n2)c1 |
| InChI | InChI=1S/C15H13IN2O2/c16-12-4-5-15-17-14(10-18(15)9-12)11-2-1-3-13(8-11)20-7-6-19/h1-5,8-10,19H,6-7H2/i16-2 |
| InChIKey | NGYZMMMCTJXETD-RFLHHMENSA-N |
| XLogP | 2.98 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|