C14H9F3N2O — CID 117130812
2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-ol (PubChem CID 117130812) has the molecular formula C14H9F3N2O and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-ol.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117130812 |
| Molecular Formula | C14H9F3N2O |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-6-ol |
| SMILES | Oc1ccc2nc(-c3ccc(C(F)(F)F)cc3)cn2c1 |
| InChI | InChI=1S/C14H9F3N2O/c15-14(16,17)10-3-1-9(2-4-10)12-8-19-7-11(20)5-6-13(19)18-12/h1-8,20H |
| InChIKey | DTLPTVNXZCBYIY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |