C16H18N2O — CID 143799480
ethane;4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenol (PubChem CID 143799480) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is ethane;4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenol.
| Compound Name | ethane;4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 143799480 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | ethane;4-(6-methylimidazo[1,2-a]pyridin-2-yl)phenol |
| SMILES | CC.Cc1ccc2nc(-c3ccc(O)cc3)cn2c1 |
| InChI | InChI=1S/C14H12N2O.C2H6/c1-10-2-7-14-15-13(9-16(14)8-10)11-3-5-12(17)6-4-11;1-2/h2-9,17H,1H3;1-2H3 |
| InChIKey | XJCPPXPDEMWZBS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |