C17H17IN2 — CID 10571546
2-(4-tert-butylphenyl)-6-iodoimidazo[1,2-a]pyridine (PubChem CID 10571546) has the molecular formula C17H17IN2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6-iodoimidazo[1,2-a]pyridine.
| Compound Name | 2-(4-tert-butylphenyl)-6-iodoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 10571546 |
| Molecular Formula | C17H17IN2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6-iodoimidazo[1,2-a]pyridine |
| SMILES | CC(C)(C)c1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C17H17IN2/c1-17(2,3)13-6-4-12(5-7-13)15-11-20-10-14(18)8-9-16(20)19-15/h4-11H,1-3H3 |
| InChIKey | PTMHHURSWIHXQK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|