C15H9IN4O — CID 16738345
3-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2,4-oxadiazole (PubChem CID 16738345) has the molecular formula C15H9IN4O and a molecular weight of 388.17 g/mol. Its IUPAC name is 3-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16738345 |
| Molecular Formula | C15H9IN4O |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 3-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]-1,2,4-oxadiazole |
| SMILES | Ic1ccc2nc(-c3ccc(-c4ncon4)cc3)cn2c1 |
| InChI | InChI=1S/C15H9IN4O/c16-12-5-6-14-18-13(8-20(14)7-12)10-1-3-11(4-2-10)15-17-9-21-19-15/h1-9H |
| InChIKey | YBTGUUIOJWNSLA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|