C15H14IN3O3 — CID 163135495
2-ethoxy-N-hydroxy-5-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzeneamine oxide (PubChem CID 163135495) has the molecular formula C15H14IN3O3 and a molecular weight of 411.20 g/mol. Its IUPAC name is 2-ethoxy-N-hydroxy-5-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzeneamine oxide.
| Compound Name | 2-ethoxy-N-hydroxy-5-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzeneamine oxide |
|---|---|
| PubChem CID | 163135495 |
| Molecular Formula | C15H14IN3O3 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-ethoxy-N-hydroxy-5-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzeneamine oxide |
| SMILES | CCOc1ccc(-c2cn3cc(I)ccc3n2)cc1[NH+]([O-])O |
| InChI | InChI=1S/C15H14IN3O3/c1-2-22-14-5-3-10(7-13(14)19(20)21)12-9-18-8-11(16)4-6-15(18)17-12/h3-9,19-20H,2H2,1H3 |
| InChIKey | HTYLLUNNUFDLMZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|