C13H11IN4 — CID 23106734
[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazine (PubChem CID 23106734) has the molecular formula C13H11IN4 and a molecular weight of 350.16 g/mol. Its IUPAC name is [4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazine.
| Compound Name | [4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 23106734 |
| Molecular Formula | C13H11IN4 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | [4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazine |
| SMILES | NNc1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C13H11IN4/c14-10-3-6-13-16-12(8-18(13)7-10)9-1-4-11(17-15)5-2-9/h1-8,17H,15H2 |
| InChIKey | KUKBECGTIWDSHC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|