C17H12IN5O2 — CID 87890400
methyl 2-cyano-2-[[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazinylidene]acetate (PubChem CID 87890400) has the molecular formula C17H12IN5O2 and a molecular weight of 445.22 g/mol. Its IUPAC name is methyl 2-cyano-2-[[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazinylidene]acetate.
| Compound Name | methyl 2-cyano-2-[[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 87890400 |
| Molecular Formula | C17H12IN5O2 |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | methyl 2-cyano-2-[[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]hydrazinylidene]acetate |
| SMILES | COC(=O)C(C#N)=NNc1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C17H12IN5O2/c1-25-17(24)14(8-19)22-21-13-5-2-11(3-6-13)15-10-23-9-12(18)4-7-16(23)20-15/h2-7,9-10,21H,1H3 |
| InChIKey | MHXPBPZOSFAABO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|