C15H12IN3O — CID 986158
N-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide (PubChem CID 986158) has the molecular formula C15H12IN3O and a molecular weight of 377.19 g/mol. Its IUPAC name is N-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide.
| Compound Name | N-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 986158 |
| Molecular Formula | C15H12IN3O |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | N-[4-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C15H12IN3O/c1-10(20)17-13-5-2-11(3-6-13)14-9-19-8-12(16)4-7-15(19)18-14/h2-9H,1H3,(H,17,20) |
| InChIKey | HOYSIAJXWAXMDV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|