C18H11IN2O2 — CID 169335680
5-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169335680) has the molecular formula C18H11IN2O2 and a molecular weight of 414.20 g/mol. Its IUPAC name is 5-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335680 |
| Molecular Formula | C18H11IN2O2 |
| Molecular Weight | 414.20 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 5-[3-(6-iodoimidazo[1,2-a]pyridin-2-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(-c3cn4cc(I)ccc4n3)c2)o1 |
| InChI | InChI=1S/C18H11IN2O2/c19-14-4-7-18-20-16(10-21(18)9-14)12-2-1-3-13(8-12)17-6-5-15(11-22)23-17/h1-11H |
| InChIKey | HJLJJBBVWZSDDA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|