C17H14N2O4 — CID 169332740
5-[3-(4,6-dimethoxypyrimidin-2-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169332740) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 5-[3-(4,6-dimethoxypyrimidin-2-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(4,6-dimethoxypyrimidin-2-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169332740 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-[3-(4,6-dimethoxypyrimidin-2-yl)phenyl]furan-2-carbaldehyde |
| SMILES | COc1cc(OC)nc(-c2cccc(-c3ccc(C=O)o3)c2)n1 |
| InChI | InChI=1S/C17H14N2O4/c1-21-15-9-16(22-2)19-17(18-15)12-5-3-4-11(8-12)14-7-6-13(10-20)23-14/h3-10H,1-2H3 |
| InChIKey | HAUMXHYKZSJAJM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|