C17H7F5O3 — CID 169333082
5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]furan-2-carbaldehyde (PubChem CID 169333082) has the molecular formula C17H7F5O3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333082 |
| Molecular Formula | C17H7F5O3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(Oc3c(F)c(F)c(F)c(F)c3F)c2)o1 |
| InChI | InChI=1S/C17H7F5O3/c18-12-13(19)15(21)17(16(22)14(12)20)25-9-3-1-2-8(6-9)11-5-4-10(7-23)24-11/h1-7H |
| InChIKey | HOBLTDWYYIQUGJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|